Rifampicin [CAS 13292-46-1]
Partner: Toronto Research Chemicals
| CAS No: | 13292-46-1 |
| MW: | 822.95 |
| Formula: | C??H??N?O?? |
| SMILES: | OC1=C(/C=N/N2CCN(C)CC2)C3=C(O)C4=C(O)C(C)=C(O[C@@](O/C=C/[C@H](OC)[C@@H](C)[C@@H](OC(C)=O)[C@H](C)[C@H](O)[C@H](C)[C@@H](O)[C@@H](C)/C=C/C=C(C)/C(N3)=O)(C)C5=O)C5=C41 |
| Description: | Appearance: Red to Dark Red Solid |
| Further Information: | Solubility: Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly) |
| Shipping Conditions: | Ship at ambient |
| Storage: | -20 C |
| Usage: | Research use only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
