Lignan P [CAS 23363-35-1]
Partner: Toronto Research Chemicals
| CAS No: | 23363-35-1 |
| MW: | 562.52 |
| Formula: | C??H??O?? |
| SMILES: | OC1=C(OC)C=C([C@H]2[C@@H](C(OC3)=O)[C@H]3[C@H](O[C@H]4[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O4)C5=C2C=C6C(OCO6)=C5)C=C1OC |
| Description: | Appearance: White to Off-White Solid |
| Further Information: | Solubility: DMSO (Slightly), Methanol (Slightly, Heated, Sonicated) |
| Shipping Conditions: | Ship at ambient |
| Storage: | -20 C, Inert atmosphere |
| Usage: | Research use only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
