Maltol-d3 [CAS 132331-92-1]
Partner: MedChemexpress LLC
| CAS No: | 132331-92-1 |
| Applications: | Cancer-programmed cell death |
| MW: | 129.13 |
| Formula: | C6H3D3O3 |
| SMILES: | O=C1C(O)=C(C([2H])([2H])[2H])OC=C1 |
| Description: | Maltol-d3 is a deuterium labeled Maltol (HY-W012788). Maltol, a type of aromatic compound, exists in high concentrations in red ginseng. Maltol is a potent antioxidative agent and typically is used to enhance flavor and preserve food[1][2]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
