Phalloidin-TRITC [CAS 915013-10-4]
Partner: MedChemexpress LLC
| CAS No: | 915013-10-4 |
| MW: | 1231.40 |
| Formula: | C60H70N12O13S2 |
| SMILES: | [O-]C(C1=C(C=CC(NC(NC[C@](C)(O)C[C@@H]2NC([C@]3([H])CC4=C(SC[C@](C(N5[C@](C[C@@H](C5)O)([H])C(N[C@H](C(N3)=O)C)=O)=O)([H])NC([C@@](NC([C@@H](NC2=O)C)=O)([H])[C@@H](O)C)=O)NC6=CC=CC=C46)=O)=S)=C1)C7=C(C=CC(N(C)C)=C8)C8=[O+]C9=C7C=CC(N(C)C)=C9)=O |
| Purity: | 97.0 |
| Description: | Phalloidin-TRITC is a fluorescein derivative of Phalloidin, which can specifically label myof lin and display red fluorescence when labeled and can be observed using Tesred channels[1]. |
| Shipping Conditions: | Ship on cold packs |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
