RETF-4NA (TFA)
Partner: MedChemexpress LLC
| Applications: | Metabolism-protein/nucleotide metabolism |
| MW: | 827.76 |
| Formula: | C34H44F3N9O12 |
| SMILES: | O=C(NC1=CC=C(C=C1)[N+]([O-])=O)[C@@H](NC([C@H]([C@H](O)C)NC([C@H](CCC(O)=O)NC([C@@H](NC(C)=O)CCCNC(N)=N)=O)=O)=O)CC2=CC=CC=C2.O=C(O)C(F)(F)F |
| Purity: | 99.65 |
| Description: | RETF-4NA TFA, a chymase-specific substrate, is a sensitive and selective substrate for chymase when free or bound to α2M[1][2]. |
| Shipping Conditions: | Ship on cold packs |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
