Myelin Basic Protein (MBP) (68-82), guinea pig [CAS 98474-59-0]
Partner: MedChemexpress LLC
| CAS No: | 98474-59-0 |
| Applications: | Neuroscience-Neuromodulation |
| MW: | 1736.79 |
| Formula: | C71H113N23O28 |
| SMILES: | NC(C[C@@H](C(O)=O)NC([C@H](CCC(O)=O)NC([C@H](CC(O)=O)NC([C@H](CCC(N)=O)NC([C@H](CO)NC([C@H](CCCNC(N)=N)NC([C@H](CCC(N)=O)NC([C@H](CO)NC([C@H](CCCCN)NC([C@H](CCC(N)=O)NC([C@H]1N(CCC1)C([C@H](CC(C)C)NC([C@H](CO)NC(CNC([C@@H](N)CC2=CC=C(C=C2)O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O |
| Purity: | 98.75 |
| Description: | Myelin Basic Protein (MBP) (68-82), guinea pig is a fragment of myelin basic protein (MBP). |
| Shipping Conditions: | Ship on cold packs |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
