NFAT Inhibitor-1 [CAS 249537-73-3]
Partner: MedChemexpress LLC
| CAS No: | 249537-73-3 |
| Applications: | COVID-19-immunoregulation |
| MW: | 1683.93 |
| Formula: | C75H118N20O22S |
| SMILES: | O=C([C@H]1N(CCC1)C(CNC([C@H](C)NC([C@@H](N)CCSC)=O)=O)=O)N[C@@H](CC2=CN=CN2)C(N3[C@@H](CCC3)C(N[C@@H](C(C)C)C(N[C@@H]([C@@H](C)CC)C(N[C@@H](C(C)C)C(N[C@@H]([C@@H](C)CC)C(N[C@@H]([C@H](O)C)C(NCC(N4[C@@H](CCC4)C(N[C@H](C(N[C@@H](CCC(O)=O)C(N[C@H](C(O)=O)CCC(O)=O)=O)=O)CC5=CN=CN5)=O)=O)=O)=O)=O)=O)=O)=O)=O |
| Purity: | 99.86 |
| Description: | NFAT Inhibitor (VIVIT peptide) is a cell-permeable peptide inhibitor of nuclear factor of activated Tcells (NFAT) that selectively inhibits calcineurin-mediated dephosphorylation of NFAT[1][2]. |
| Shipping Conditions: | Ship on cold packs |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
