Ro 3-1314 [CAS 2012-14-8]
Partner: MedChemexpress LLC
| CAS No: | 2012-14-8 |
| Applications: | Metabolism-sugar/lipid metabolism |
| MW: | 276.41 |
| Formula: | C18H28O2 |
| SMILES: | O=C(CCCCCCCC#CCC#CCCCCC)O |
| Purity: | 99.0 |
| Description: | Ro 3-1314 (9a,12a-Octadecadiynoic acid) is a plant lipoxygenase inhibitor. Ro 3-1314 is a linoleic acid metabolism inhibitor. Ro 3-1314 stimulates the antigen-induced contraction of guinea-pig tracheal spirals and the immunological release of slow reacting substance of anaphylaxis (SRS-A) from actively sensitized guinea-pig lung fragments[1]. |
| Shipping Conditions: | Ship on cold packs |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
