(-)-Maackiain [CAS 2035-15-6]
Partner: MedChemexpress LLC
| CAS No: | 2035-15-6 |
| Applications: | COVID-19-immunoregulation |
| MW: | 284.26 |
| Formula: | C16H12O5 |
| SMILES: | OC1=CC=C([C@@]2([H])[C@@](C3=C(C=C4C(OCO4)=C3)O2)([H])CO5)C5=C1 |
| Purity: | 99.91 |
| Description: | (-)-Maackiain is a pterocarpan phytoalexin produced from Sophora flavescens. (-)-Maackiain is toxic to several genera of fungal pathogens of legume and non legume hosts[1]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
