(-)-Butin [CAS 492-14-8]
Partner: MedChemexpress LLC
| CAS No: | 492-14-8 |
| Applications: | COVID-19-immunoregulation |
| MW: | 272.25 |
| Formula: | C15H12O5 |
| SMILES: | O=C1C[C@@H](C2=CC=C(O)C(O)=C2)OC3=CC(O)=CC=C13 |
| Purity: | 99.89 |
| Description: | (-)-Butin is the S enantiomer of Butin. Butin is a major biologically active flavonoid isolated from the heartwood of Dalbergia odorifera, with strong antioxidant, antiplatelet and anti-inflammatory activities[1][2]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
