Periplocoside N [CAS 39946-41-3]
Partner: MedChemexpress LLC
| CAS No: | 39946-41-3 |
| Applications: | COVID-19-immunoregulation |
| MW: | 464.63 |
| Formula: | C27H44O6 |
| SMILES: | C[C@@]12[C@](CC[C@]2(O)[C@H](C)O[C@H]3C[C@H]([C@H](O)[C@@H](C)O3)O)([H])[C@@]4([H])[C@]([C@@]5(C(C[C@@H](O)CC5)=CC4)C)([H])CC1 |
| Purity: | 96.32 |
| Description: | Periplocoside N, a pregnane glycoside isolated from root powder of Periploca sepium, possesses insecticidal activities against the red imported fire ant[1]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
