Aloe-emodin-8-O-Beta-D-glucopyranoside [CAS 33037-46-6]
Partner: MedChemexpress LLC
| CAS No: | 33037-46-6 |
| Applications: | Metabolism-sugar/lipid metabolism |
| MW: | 432.38 |
| Formula: | C21H20O10 |
| SMILES: | O=C(C1=CC(CO)=CC(O)=C1C2=O)C3=C2C(O[C@@H]4O[C@@H]([C@@H](O)[C@H](O)[C@H]4O)CO)=CC=C3 |
| Purity: | 99.0 |
| Description: | Aloe-emodin-8-O-?-D-glucopyranoside, a compound isolated from Saussrurea lappa, is a moderate inhibitor of human protein tyrosine phosphatase 1B (hPTP1B) with an IC50 of 26.6 ?M[1]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
