Mu tanocyclin [CAS 875455-92-8]
Partner: MedChemexpress LLC
| CAS No: | 875455-92-8 |
| MW: | 197.23 |
| Formula: | C10H15NO3 |
| SMILES: | O=C1[C@@H](CC(C)C)NC(O)=C1C(C)=O |
| Purity: | 99.76 |
| Description: | Mutanocyclin is a potent antifungal agent. Mutanocyclin inhibits Candida albicans (C. albicans) filamentation. Mutanocyclin decreases the mRNA expression of HWP1, ECE1, FLO8, TEC1. Mutanocyclin inhibits yeast-form in ex vivo mouse[1]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
