Linoleic acid-13C18 [CAS 287111-25-5]
Partner: MedChemexpress LLC
| CAS No: | 287111-25-5 |
| Applications: | Metabolism-protein/nucleotide metabolism |
| MW: | 298.31 |
| Formula: | 13C18H32O2 |
| SMILES: | [13CH3][13CH2][13CH2][13CH2][13CH2][13CH]=[13CH][13CH2][13CH]=[13CH][13CH2][13CH2][13CH2][13CH2][13CH2][13CH2][13CH2][13C](O)=O |
| Purity: | 95.0 |
| Description: | Linoleic acid-13C18 is the 13C labeled Linoleic acid. Linoleic acid is a common polyunsaturated (PUFA) found in plant-based oils, nuts and seeds. Linoleic acid is a part of membrane phospholipids, and functions as a structural component to maintain a certain level of membrane fluidity of the transdermal water barrier of the epidermis. Linoleic acid induces red blood cells and hemoglobin damage via oxidative mechanism [1][2]. |
| Shipping Conditions: | Ship on cold packs |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
