Neochlorogenic acid [CAS 906-33-2]
Partner: MedChemexpress LLC
| CAS No: | 906-33-2 |
| Applications: | COVID-19-immunoregulation |
| MW: | 354.31 |
| Formula: | C16H18O9 |
| SMILES: | O=C([C@]1(O)C[C@@H](OC(/C=C/C2=CC=C(O)C(O)=C2)=O)[C@@H](O)[C@H](O)C1)O |
| Purity: | 99.07 |
| Description: | Neochlorogenic acid is a natural polyphenolic compound found in dried fruits and other plants. Neochlorogenic acid inhibits the production of TNF-? and IL-1?. Neochlorogenic acid suppresses iNOS and COX-2 protein expression. Neochlorogenic acid also inhibits phosphorylated NF-?B p65 and p38 MAPK activation. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
