Qingyangshengenin B [CAS 106758-54-7]
Partner: MedChemexpress LLC
| CAS No: | 106758-54-7 |
| Applications: | Neuroscience-Neurodegeneration |
| MW: | 923.13 |
| Formula: | C49H78O16 |
| SMILES: | O[C@]([C@@]([C@]1([H])C2)(CC=C3[C@@]1(CC[C@H](O[C@@](O[C@H](C)[C@H]4O[C@@](O[C@H](C)[C@H]5O[C@@](O[C@H](C)[C@H]6O)([H])C[C@H]6OC)([H])C[C@@H]5OC)([H])C[C@@H]4OC)C3)C)O)(CC[C@@]7(O)C(C)=O)[C@@]7([C@@H]2OC(/C=C(C)/C(C)C)=O)C |
| Description: | Qingyangshengenin B, a C-21 steroidal glycoside isolated from Qingyangshen. Qingyangshengenin B protects against A? toxicity, which decreases A? deposition by decreasing the expression of A? at the mRNA level. Qingyangshengenin B has antiepileptic activity[1][2][3]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
