(-)-Alpha-Pinene [CAS 7785-26-4] (10mM in DMSO)
Partner: MedChemexpress LLC
| CAS No: | 7785-26-4 |
| Applications: | Neuroscience-Neuromodulation |
| MW: | 136.23 |
| Formula: | C10H16 |
| SMILES: | CC1(C)[C@@]2([H])CC=C(C)[C@]1([H])C2 |
| Purity: | 99.63 |
| Description: | (-)-α-Pinene is a monoterpene and shows sleep enhancing property through a direct binding to GABAA-benzodiazepine (BZD) receptors by acting as a partial modulator at the BZD binding site[1]. |
| Shipping Conditions: | Ship on cold packs |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
