Lycopene [CAS 502-65-8]
Partner: MedChemexpress LLC
| CAS No: | 502-65-8 |
| Applications: | COVID-19-immunoregulation |
| MW: | 536.87 |
| Formula: | C40H56 |
| SMILES: | C/C(C)=C\CC/C(C)=C/C=C/C(C)=C/C=C/C(C)=C/C=C/C=C(/C=C/C=C(C)/C=C/C=C(CC/C=C(C)\C)\C)C |
| Purity: | 99.11 |
| Description: | Lycopene is naturally occurring carotenoids found in tomato, tomato products, and in other red fruits and vegetables; exhibits antioxidant effects. |
| Shipping Conditions: | Ship on dry ice |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
