4-Methylumbelliferyl phosphate [CAS 3368-04-5]
Partner: MedChemexpress LLC
| CAS No: | 3368-04-5 |
| Applications: | Neuroscience-Neuromodulation |
| MW: | 256.15 |
| Formula: | C10H9O6P |
| SMILES: | O=C1C=C(C)C2=CC=C(OP(O)(O)=O)C=C2O1 |
| Purity: | 99.96 |
| Description: | 4-Methylumbelliferyl phosphate (4-MUP), an anionic organophosphate, is a acid and alkaline phosphatase fluorogenic substrate. 4-Methylumbelliferyl phosphate is also a nerve agent simulant[1][2][3]. |
| Shipping Conditions: | Ship on cold packs |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
