Canthaxanthin [CAS 514-78-3]
Partner: MedChemexpress LLC
CAS No: | 514-78-3 |
Applications: | Cancer-programmed cell death |
MW: | 564.84 |
Formula: | C40H52O2 |
SMILES: | CC(/C=C/C(C(C)(CCC1=O)C)=C1C)=C\C=C\C(C)=C\C=C\C=C(C)\C=C\C=C(C)\C=C\C(C(C)(CCC2=O)C)=C2C |
Purity: | 99.0 |
Description: | Canthaxanthin is a red-orange carotenoid with various biological activities, such as antioxidant, antitumor properties. |
Shipping Conditions: | Ship on dry ice |
Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice