Dapoxetine (hydrochloride) [CAS 129938-20-1]
Partner: MedChemexpress LLC
| CAS No: | 129938-20-1 |
| Applications: | Neuroscience-Neuromodulation |
| MW: | 341.87 |
| Formula: | C21H24ClNO |
| SMILES: | CN(C)[C@H](C1=CC=CC=C1)CCOC2=C3C(C=CC=C3)=CC=C2.Cl |
| Purity: | 99.93 |
| Description: | Dapoxetine (LY-210448) hydrochloride is an orally active and selective serotonin reuptake inhibitor (SSRI). Dapoxetine hydrochloride can be used for the research of premature ejaculation (PE)[1]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
