Nafamostat (mesylate) [CAS 82956-11-4]
Partner: MedChemexpress LLC
| CAS No: | 82956-11-4 |
| Applications: | COVID-19-anti-virus |
| MW: | 539.58 |
| Formula: | C21H25N5O8S2 |
| SMILES: | CS(=O)(O)=O.O=C(OC1=CC=C2C=C(C(N)=N)C=CC2=C1)C3=CC=C(NC(N)=N)C=C3.CS(=O)(O)=O |
| Purity: | 99.97 |
| Description: | Nafamostat mesylate (FUT-175), an anticoagulant, is a synthetic serine protease inhibitor. Nafamostat mesylate has anticancer and antivirus effect. Nafamostat mesylate induce apoptosis by up-regulating the expression of tumor necrosis factor receptor-1 (TNFR1). Nafamostat mesylate can be used in the development of the pathological thickening of the arterial wall[1][2]3][4]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
