3Alpha-Aminocholestane [CAS 2206-20-4]
Partner: MedChemexpress LLC
| CAS No: | 2206-20-4 |
| Applications: | Cancer-programmed cell death |
| MW: | 387.68 |
| Formula: | C27H49N |
| SMILES: | CC(C)CCC[C@@H](C)[C@@]1([H])CC[C@@]2([H])[C@]3([H])CC[C@@]4([H])C[C@H](N)CC[C@]4(C)[C@@]3([H])CC[C@@]21C |
| Purity: | 98.0 |
| Description: | 3?-Aminocholestane is a selective SH2 domain-containing inositol-5?-phosphatase 1 (SHIP1) inhibitor with an IC50 of ~2.5 ?M. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
