CCT007093 [CAS 176957-55-4]
Partner: MedChemexpress LLC
| CAS No: | 176957-55-4 |
| Applications: | Cancer-Kinase/protease |
| MW: | 272.39 |
| Formula: | C15H12OS2 |
| SMILES: | O=C1/C(CC/C1=C\C2=CC=CS2)=C/C3=CC=CS3 |
| Purity: | 98.01 |
| Description: | CCT007093 is an effective protein phosphatase 1D (PPM1D Wip1) inhibitor. Wip1 inhibition can activate the mTORC1 pathway and enhance hepatocyte proliferation after hepatectomy[1][2]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
