MRS 1754 [CAS 264622-58-4]
Partner: MedChemexpress LLC
| CAS No: | 264622-58-4 |
| Applications: | COVID-19-immunoregulation |
| MW: | 486.52 |
| Formula: | C26H26N6O4 |
| SMILES: | O=C(NC1=CC=C(C#N)C=C1)COC2=CC=C(C(N3)=NC(N(CCC)C(N4CCC)=O)=C3C4=O)C=C2 |
| Purity: | 98.31 |
| Description: | MRS 1754 is a selective antagonist radioligand for A2B adenosine receptor with very low affinity for A1 and A3 receptors of both humans and rats[1]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
