N-Decanoyl-L-homoserine lactone [CAS 177315-87-6]
Partner: MedChemexpress LLC
| CAS No: | 177315-87-6 |
| Applications: | COVID-19-immunoregulation |
| MW: | 255.35 |
| Formula: | C14H25NO3 |
| SMILES: | CCCCCCCCCC(N[C@@H]1C(OCC1)=O)=O |
| Purity: | 99.43 |
| Description: | N-decanoyl-L-homoserine lactone (C10-HSL) is a N-acyl-homoserine lactone (AHL) N-decanoyl-L-homoserine lactone can inhibit primary root growth in Arabidopsis. N-decanoyl-L-homoserine lactone triggers a transient and immediate increase in the concentrations of cytosolic free Ca2+ and reactive oxygen species (ROS), increases the activity of mitogen-activated protein kinase 6 (MPK6), and induces nitric oxide (NO) production in Arabidopsis roots[1]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
