Cutamesine dihydrochloride [CAS 165377-44-6]
Partner: MedChemexpress LLC
| CAS No: | 165377-44-6 |
| Applications: | Neuroscience-Neuromodulation |
| MW: | 441.43 |
| Formula: | C23H34Cl2N2O2 |
| SMILES: | COC1=CC=C(CCN2CCN(CCCC3=CC=CC=C3)CC2)C=C1OC.Cl.Cl |
| Purity: | 98.01 |
| Description: | Cutamesine dihydrochloride (SA4503 dihydrochloride; AGY94806 dihydrochloride) is a potent Sigma 1 receptor agonist with an IC50 of 17.4 nM in guinea pig brain membranes. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
