AP-1/NF-Kappa B activation inhibitor 1 [CAS 188936-12-1]
Partner: MedChemexpress LLC
| CAS No: | 188936-12-1 |
| Applications: | COVID-19-immunoregulation |
| MW: | 344.25 |
| Formula: | C13H11F3N4O4 |
| SMILES: | O=C(C1=CN=C(C(F)(F)F)N=C1NN2C(C(C)=CC2=O)=O)OCC |
| Purity: | 99.03 |
| Description: | AP-1/NF-?B activation inhibitor 1 is a potent AP-1 and NF-?B mediated transcriptional activation inhibitor (IC50=1 ?M), without blocking basal transcription driven by the ?-actin promoter. AP-1/NF-?B activation inhibitor 1 has a similar inhibitory effect on the production of IL-2 and IL-8 levels in stimulated cells[1]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
