TAME [CAS 901-47-3]
Partner: MedChemexpress LLC
| CAS No: | 901-47-3 |
| Applications: | Cancer-programmed cell death |
| MW: | 342.41 |
| Formula: | C14H22N4O4S |
| SMILES: | CC1=CC=C(C=C1)S(N[C@H](C(OC)=O)CCCNC(N)=N)(=O)=O |
| Purity: | 99.51 |
| Description: | TAME is an inhibitor of anaphase-promoting complex/cyclosome (APC/C or APC), which binds to APC/C and prevents its activation by Cdc20 and Cdh1, produces mitotic arrest. TAME is not cell permeable[1][2]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
