MP-PEG4-Val-Lys-Gly-7-MAD-MDCPT [CAS 2378428-19-2]
Partner: MedChemexpress LLC
| CAS No: | 2378428-19-2 |
| Applications: | Cancer-programmed cell death |
| MW: | 1104.17 |
| Formula: | C53H69N9O17 |
| SMILES: | O=C(C=CC1=O)N1CCC(NCCOCCOCCOCCOCCC(N[C@@H](C(C)C)C(N[C@@H](CCCCN)C(NCC(NCC2=C3C(C(N4C3)=CC([C@](O)(C(OC5)=O)CC)=C5C4=O)=NC6=CC(OCO7)=C7C=C62)=O)=O)=O)=O)=O |
| Purity: | 99.81 |
| Description: | MP-PEG4-Val-Lys-Gly-7-MAD-MDCPT is a Camptothecin-linker compound extracted from patent WO2019195665A1, example 4-1. MP-PEG4-Val-Lys-Gly-7-MAD-MDCPT is a agent-linker conjugate for antibody-drug conjugate (ADC)[1]. |
| Shipping Conditions: | Ship on cold packs |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
