5-FAM-Alkyne [CAS 510758-19-7]
Partner: MedChemexpress LLC
| CAS No: | 510758-19-7 |
| Applications: | Metabolism-sugar/lipid metabolism |
| MW: | 413.38 |
| Formula: | C24H15NO6 |
| SMILES: | OC(C=C1)=CC2=C1C3(C(C=CC(C(NCC#C)=O)=C4)=C4C(O3)=O)C(C=CC(O)=C5)=C5O2 |
| Purity: | 95.0 |
| Description: | 5-FAM-Alkyne is a high selective and sensitive fluorescent biosensor for alkaline phosphatase (ALP)[1]. 5-FAM-Alkyne is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
