Apcin-A [CAS 1683617-62-0]
Partner: MedChemexpress LLC
| CAS No: | 1683617-62-0 |
| Applications: | Cancer-programmed cell death |
| MW: | 342.61 |
| Formula: | C10H14Cl3N5O2 |
| SMILES: | O=C(OCCCN)NC(NC1=NC=CC=N1)C(Cl)(Cl)Cl |
| Purity: | 98.0 |
| Description: | Apcin-A, an Apcin derivative, is an anaphase-promoting complex (APC) inhibitor. Apcin-A interacts strongly with Cdc20, and inhibits the ubiquitination of Cdc20 substrates. Apcin-A can be used to synthesize the PROTAC CP5V (HY-130257)[1]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
