NCGC00262650 [CAS 344359-25-7]
Partner: MedChemexpress LLC
| CAS No: | 344359-25-7 |
| Applications: | COVID-19-immunoregulation |
| MW: | 308.38 |
| Formula: | C18H20N4O |
| SMILES: | NC1=C2C(N(C3CCCC3)C=C2C4=CC=C(OC)C=C4)=NC=N1 |
| Description: | NCGC00262650 is a potent apical membrane antigen 1-rhoptry neck protein 2 (AMA1-RON2) interaction inhibitor. NCGC00262650 can block entry of merozoites into red blood cells[1]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
