proTAME [CAS 1362911-19-0] (10mM in DMSO)
Partner: MedChemexpress LLC
| CAS No: | 1362911-19-0 |
| Applications: | Cancer-Kinase/protease |
| MW: | 726.75 |
| Formula: | C34H38N4O12S |
| SMILES: | O=C(CC1=CC=CC=C1)OCOC(N/C(NC(OCOC(CC2=CC=CC=C2)=O)=O)=N/CCC[C@@H](C(OC)=O)NS(=O)(C3=CC=C(C=C3)C)=O)=O |
| Purity: | 99.94 |
| Description: | proTAME, a cell-permeable proagent form of TAME, is an anaphase promoting complex/cyclosome (APC/C) inhibitor. proTAME causes cell cycle arrest in metaphase[1][2]. |
| Shipping Conditions: | Ship on cold packs |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
