BCI-215 [CAS 1245792-67-9] (10mM in DMSO)
Partner: MedChemexpress LLC
| CAS No: | 1245792-67-9 |
| Applications: | Cancer-Kinase/protease |
| MW: | 396.32 |
| Formula: | C22H22BrNO |
| SMILES: | O=C1/C(C(NC2CCCCC2)C3=C1C=CC(Br)=C3)=C/C4=CC=CC=C4 |
| Purity: | 99.84 |
| Description: | BCI-215 is a potent and tumor cell-selective dual specificity MAPK phosphatase (DUSP-MKP) inhibitor. BCI-215 has cytotoxicity for tumor cells but not normal cells[1][2]. |
| Shipping Conditions: | Ship on cold packs |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
