MRT00033659 [CAS 1401731-54-1]
Partner: MedChemexpress LLC
| CAS No: | 1401731-54-1 |
| Applications: | Cancer-Kinase/protease |
| MW: | 266.30 |
| Formula: | C15H14N4O |
| SMILES: | CC1=NNC2=NC=C(C=C21)C3=CC=CC(NC(C)=O)=C3 |
| Purity: | 99.77 |
| Description: | MRT00033659 is a potent broad-spectrum kinase inhibitor of CK1 (IC50=0.9 �M for CK1?) and CHK1 (IC50=0.23 �M). MRT00033659, a pyrazolo-pyridine analogue, induces p53 pathway activation and E2F-1 destabilisation[1]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
