TASIN-1 [CAS 792927-06-1]
Partner: MedChemexpress LLC
| CAS No: | 792927-06-1 |
| Applications: | Cancer-programmed cell death |
| MW: | 352.49 |
| Formula: | C18H28N2O3S |
| SMILES: | CC1CCN(C2CCN(S(=O)(C3=CC=C(OC)C=C3)=O)CC2)CC1 |
| Purity: | 99.91 |
| Description: | TASIN-1 is a selective inhibitor of truncated APC gene (adenomatous polyposis coli gene) and exerts cytotoxic effects through inhibition of cholesterol biosynthesis. TASIN-1 represents a potential therapeutic strategy for prevention and intervention in CRC with mutant APC[1]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
