BCI (hydrochloride) [CAS 95130-23-7]
Partner: MedChemexpress LLC
| CAS No: | 95130-23-7 |
| Applications: | COVID-19-immunoregulation |
| MW: | 353.89 |
| Formula: | C22H24ClNO |
| SMILES: | O=C1/C(C(NC2CCCCC2)C3=C1C=CC=C3)=C/C4=CC=CC=C4.Cl |
| Purity: | 99.89 |
| Description: | BCI ((E)-BCI) hydrochloride is a DUSP6 (dual specificity phosphatase 6) inhibitor. BCI hydrochloride shows anti-inflammatory activity and decreases reactive oxygen species (ROS) production. BCI hydrochloride can be used in inflammatory disease research[1][2]. |
| Shipping Conditions: | Ship on cold packs |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
