PLX5622 [CAS 1303420-67-8] (10mM in DMSO)
Partner: MedChemexpress LLC
| CAS No: | 1303420-67-8 |
| Applications: | Neuroscience-Neuromodulation |
| MW: | 395.41 |
| Formula: | C21H19F2N5O |
| SMILES: | COC1=NC=C(F)C=C1CNC2=NC(F)=C(CC3=CNC4=NC=C(C)C=C43)C=C2 |
| Purity: | 99.95 |
| Description: | PLX5622 is a highly selective brain penetrant and orally active CSF1R inhibitor (IC50=0.016 �M; Ki=5.9 nM). PLX5622 allows for extended and specific microglial cells elimination, preceding and during pathology development. PLX5622 demonstrates desirable PK properties in varies animals. PLX5622 is mostly used in the way of feed free diet (HY-114153C)[1][2]. |
| Shipping Conditions: | Ship on cold packs |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
