1-Naphthyl phosphate (potassium salt) [CAS 100929-85-9]
Partner: MedChemexpress LLC
| CAS No: | 100929-85-9 |
| Applications: | Metabolism-sugar/lipid metabolism |
| MW: | 300.33 |
| Formula: | C10H7K2O4P |
| SMILES: | O=P(O[K])(O[K])OC1=C2C=CC=CC2=CC=C1 |
| Description: | 1-Naphthyl phosphate potassium salt is a non-specific phosphatase inhibitor. 1-Naphthyl phosphate potassium salt decreases the splice-correcting effect[1]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
