N6-Etheno 2'-deoxyadenosine [CAS 68498-25-9]
Partner: MedChemexpress LLC
| CAS No: | 68498-25-9 |
| Applications: | COVID-19-anti-virus |
| MW: | 275.26 |
| Formula: | C12H13N5O3 |
| SMILES: | O[C@@H](C1)[C@@H](CO)O[C@H]1N(C=N2)C3=C2C4=NC=CN4C=N3 |
| Purity: | 99.48 |
| Description: | N6-Etheno 2'-deoxyadenosine is a reactive oxygen species (ROS)/reactive nitrogen species (RNS)-induced DNA oxidation product, used as a biomarker to evaluate chronic inflammation and lipid peroxidation in animal or human tissues[1]. |
| Shipping Conditions: | Ship on cold packs |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
