APC 366 [CAS 158921-85-8]
Partner: MedChemexpress LLC
| CAS No: | 158921-85-8 |
| Applications: | COVID-19-immunoregulation |
| MW: | 440.50 |
| Formula: | C22H28N6O4 |
| SMILES: | OC1=C(C(N[C@@H](CCCNC(N)=N)C(N2[C@@H](CCC2)C(N)=O)=O)=O)C=CC3=C1C=CC=C3 |
| Description: | APC 366 is a selective inhibitor of mast cell tryptase (Ki=7.1 ?M). APC 366 inhibits antigen-induced early asthmatic response (EAR), late asthmatic response (LAR), and bronchial hyperresponsiveness (BHR) in a sheep model of allergic asthma[1][2]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
