MRS1845 [CAS 544478-19-5]
Partner: MedChemexpress LLC
| CAS No: | 544478-19-5 |
| Applications: | Neuroscience-Neuromodulation |
| MW: | 398.41 |
| Formula: | C21H22N2O6 |
| SMILES: | O=C(C1=C(C)N(CC#C)C(C)=C(C(OC)=O)C1C2=CC=CC([N+]([O-])=O)=C2)OCC |
| Purity: | 99.69 |
| Description: | MRS1845 is a selective store-operated calcium (SOC) channel inhibitor with an IC50 of 1.7 ?M[1]. MRS1845 is an ORAI1 inhibitor[2][3]. MRS1845 is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
