CFM-4 [CAS 331458-02-7]
Partner: MedChemexpress LLC
| CAS No: | 331458-02-7 |
| Applications: | Cancer-programmed cell death |
| MW: | 405.90 |
| Formula: | C22H16ClN3OS |
| SMILES: | O=C1N(CC2=CC=CC=C2Cl)C3=C(C=CC=C3)C14SC(C5=CC=CC=C5)=NN4 |
| Purity: | 98.85 |
| Description: | CFM-4 is a potent small molecular antagonist of CARP-1/APC-2 binding. CFM-4 prevents CARP-1 binding with APC-2, causes G2M cell cycle arrest, and induces apoptosis with an IC50 range of 10-15 ?M. CFM-4 also suppresses growth of drug-resistant human breast cancer cells[1]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
