(-)-Enitociclib [CAS 1610358-59-2]
Partner: MedChemexpress LLC
| CAS No: | 1610358-59-2 |
| Applications: | Neuroscience-Neuromodulation |
| MW: | 404.43 |
| Formula: | C19H18F2N4O2S |
| SMILES: | N=S(CC1=CC(NC2=NC=C(F)C(C3=CC=C(F)C=C3OC)=C2)=NC=C1)(C)=O |
| Purity: | 99.81 |
| Description: | (-)-Enitociclib ((R)-Enitociclib) is an enanthiomer of BAY-1251152 with rotation (-). BAY-1251152 is a potent and highly selective PTEF/CDK9 inhibitor. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
