Prodipine hydrochloride [CAS 31314-39-3]
Partner: MedChemexpress LLC
| CAS No: | 31314-39-3 |
| Applications: | Neuroscience-Neuromodulation |
| MW: | 315.88 |
| Formula: | C20H26ClN |
| SMILES: | CC(C)N1CCC(C2=CC=CC=C2)(CC1)C3=CC=CC=C3.Cl |
| Purity: | 99.84 |
| Description: | Prodipine, a diphenyl-phosphonate derivative. The IC50s of Prodipine for purified and plasma Dipeptidyl peptidase IV (DPP IV) from the rabbit are 4.5 ?M and 30 ?M, respectively. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
