A12B4C3 [CAS 1005129-80-5]
Partner: MedChemexpress LLC
| CAS No: | 1005129-80-5 |
| Applications: | Cancer-Kinase/protease |
| MW: | 534.65 |
| Formula: | C30H38N4O5 |
| SMILES: | O=C1N(C(C2N(C(C(CCCCCCCCCC)O)C=CC12)NC3=CC=C([N+]([O-])=O)C=C3)=O)C4=CC=CC=C4 |
| Purity: | 98.0 |
| Description: | A12B4C3 is a potent human polynucleotide kinase/phosphatase (hPNKP) inhibitor with an IC50 value of 0.06 ?M. A12B4C3 has antiproliferative activity against cancer cells. A12B4C3 can also enhance the radiosensitivity of certain cancer cells[1]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
