Chlorobis(ethylene)rhodium(I) Dimer [CAS 12081-16-2]
Partner: Toronto Research Chemicals
| CAS No: | 12081-16-2 |
| MW: | 388.93 |
| Formula: | C?H??Cl?Rh? |
| SMILES: | [Cl-]1[Rh+]23([Cl-][Rh+]145([CH2]=[CH2]4)[CH2]=[CH2]5)([CH2]=[CH2]2)[CH2]=[CH2]3 |
| Description: | Appearance: Red to Very Dark Red Solid |
| Further Information: | Solubility: Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly) |
| Shipping Conditions: | Ship at ambient |
| Storage: | 4 C, Inert atmosphere |
| Usage: | Research use only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
