MMP-7-IN-2 [CAS 2848717-49-5]
Partner: MedChemexpress LLC
| CAS No: | 2848717-49-5 |
| Applications: | Metabolism-protein/nucleotide metabolism |
| MW: | 729.17 |
| Formula: | C28H40ClF3N6O9S |
| SMILES: | O=[S](N[C@H](C(O)=O)CCC(NCC(N[C@@H](CC(C)C)C(N[C@@H](C(C)C)C(N[C@@H](C)C(N)=O)=O)=O)=O)=O)(C(C=C1)=CC(C(F)(F)F)=C1Cl)=O |
| Purity: | 99.34 |
| Description: | MMP-7-IN-2 (comp 16) is a selective MMP7 inhibitor, with an IC50 of 16 nM[1]. |
| Shipping Conditions: | Ship on cold packs |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
