CAS No: | 6485-40-1 |
Applications: | Neuroscience-Neuromodulation |
MW: | 150.22 |
Formula: | C10H14O |
SMILES: | O=C1C(C)=CC[C@@H](C(C)=C)C1 |
Purity: | 99.55 |
Description: | (-)-Carvone is an insect neurotoxin and a irreversible acetylcholinesterase (AChE) inhibitor. (-)-Carvone can be used as a bird repellent, inhibits larval growth, decreases pupatation rate, and increases mortality of larvae[1][2]. |
Shipping Conditions: | Ship at ambient |
Storage: | -20°C, 3 years; 4°C, 2 years (Powder) |
Usage: | Research Use only |